/* wolf 0.7, a lightweight framework for web page creation.
* Copyright 2020 XWolfOverride (under lockdown)
*
* Licensed under the MIT License
*
* Permission is hereby granted, free of charge, to any person obtaining a copy of this software
* and associated documentation files (the "Software"), to deal in the Software without restriction,
* including without limitation the rights to use, copy, modify, merge, publish, distribute,
* sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is
* furnished to do so, subject to the following conditions:
*
* The above copyright notice and this permission notice shall be included in all copies or
* substantial portions of the Software.
*
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING
* BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
* NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
* DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
*/
/**
* @typedef {object} element DOM element node
*/
var wolf = (() => {
'use strict';
// ==== Global tools ====
if (!Object.prototype.merge)
Object.defineProperty(Object.prototype, "merge", {
writable: true,
value: function (src) {
if (!src)
return this;
for (var key in src)
this[key] = src[key];
return this;
}
});
window.byId = id => document.getElementById(id);
// ==== Kernel ==== resources loading, initializaiton and process handling
var K = (() => {
var objs = {}; //Map of objects by url
var configuration = {
trimTextNodes: true,
};
/**
* Declare an xWeb object,
* any string parameter will be treated as dependence and the object parameter will be loaded and
* passed prior to the object initialization function.
* @param {object} objd object definition
* @param {function} [callback] callback to be called once the object has been loaded
*/
function instantiate(objd, callback) {
var deps = {};
var constructor;
// ==== Process arguments
for (var i in objd) {
var a = objd[i];
switch (typeof (a)) {
case "string":
deps[a] = null;
break;
case "function":
if (constructor)
throw new Error("Object definition with multiple constructors");
constructor = a;
}
}
if (!constructor)
throw new Error("Object definition without logic body");
// ==== Process dependencies
function checkFinish() {
if (!constructor)
return;
for (var a in deps) {
if (!deps[a])
return;
}
var args = [];
for (var a in deps)
args.push(deps[a]);
var obj = constructor.apply({}, args);
constructor = null;
callback && callback(obj);
}
function checkFactory(name) { //Function factory, a way to isaolate parameter value by scope
return (obj) => {
deps[name] = obj;
checkFinish();
}
}
for (var i in deps)
require(i, checkFactory(i));
checkFinish();
}
/**
* Fetch an object from url and instantiate
* @param {string} url Url of object to fetch
* @param {function} [callback] callback to be called once the object has been loaded
* @param {fetcher_callfail} [callfail] callback to be called once the object has been loaded
*/
function require(url, callback) {
if (!url)
return;
url = new URL(url, document.baseURI).href;
var obj = objs[url];
if (!obj) {
TOOLS.wGet(url, data => {
var inc = Function(`'use strict';return ${data};\n//# sourceURL=${url}`);
instantiate(inc(), (lobj) => {
objs[url] = lobj;
callback && callback(lobj);
});
});
} else
callback && callback(obj);
}
/**
* Object for callback storage and handling
* @constructor
*/
function CallbackList() { // Meant to be used with 'new' instanciation, do not use the return object
var cbs = [];
/**
* Add the callback to the list of pending callbacks to be executed
* @param {function} callback callback to add
* @param {*} ctx context of the callback
* @param {array} params parameters to use on execution (see fire)
*/
function add(callback, ctx, params) {
callback && cbs.push({ cb: callback, ctx: ctx, p: params });
}
/**
* Execute the callback list in order of adding, if params argument is not null the add params will be ignored
* @param {array} params execute all the callbacks with this parameters and not the one specified in add method
*/
function fire(params) {
var cblist = cbs;
cbs = []; //Clear callback list and avoid execution repetition
for (var i in cblist) {
var cb = cblist[i];
cb.cb.apply(cb.ctx, params ? params : cb.p);
}
}
this.add = add;
this.fire = fire;
};
/**
* Load Handler for multiple load control.
* Create a new instance with new, passing the callback to execute when on finished.
* Before starting a load request, call method enter()
* Once data is dloaded, call the leave() method
* If the last leave is called, then the onFinish callback gets executed
* @param {function} onFinish
*/
function LoadHandler(onFinish) {
var counter = 0;
onFinish = [onFinish];
function fireFinish() {
for (var i in onFinish)
onFinish[i]();
}
/**
* Enter one level of wait state
*/
this.enter = function () {
counter++;
}
/**
* Leaves one level of wait state, when all wait states gets clear then fires onFinish.
*/
this.leave = function () {
counter--;
if (counter <= 0) {
counter = 0;
fireFinish();
}
}
/**
* Clear all the wait states and fire onFinish.
*/
this.clear = function () {
counter = 0;
fireFinish();
}
/**
* Returns true if the onFinis has been fired.
*/
this.isDone = function () {
return coutner == 0;
}
/**
* Add another callback to execute when wait states cleared.
* Callbacks are executed sequentially
* @param {function} functionFinish callback to add
*/
this.addFinish = function (functionFinish) {
onFinish.push(functionFinish);
}
}
/**
* MultiPromise is a Promise with multiple lock ids, thenonly fired when all locks has been filled.
* @param {*} [data] Object with additional information to pass to the then section.
*/
function MultiPromise(data) {
var locks = {};
var cbDone;
/**
* Checks the locks and fires the then in case of resolution
*/
function check() {
if (!locks)
return; //already resolved (ok or rejected)
for (var k in locks)
if (!locks[k])
return; //not finised
var result = locks;
locks = null; //mark as done
cbDone(result);
}
/**
* Merge data into the multipromise additional data
* @param {*} obj object to merge with additional data
*/
function merge(obj) {
data = data || {};
data.merge(obj);
return this;
};
/**
* Adds a new lock to the Multipromise and executes the resolver function
* @param {string} id Id of lock
* @param {function} resolver Resolver function
*/
function lock(id, resolver) {
locks[id] = null;
function resolve(value) {
locks[id] = {
ok: true,
value: value
};
check();
}
function reject(reason) {
locks[id] = {
ok: false,
reason: reason,
}
check();
}
setTimeout(() => {
try {
resolver(resolve, reject);
} catch (err) {
reject(err);
}
});
return this;
}
/**
* Installs the callbacks to execute on resolution.
* @param {function} cbFinish Function to execute when all locks has been resolved.
*/
function then(cbFinish) {
cbDone = cbFinish;
return this;
}
this.merge = merge;
this.lock = lock;
this.then = then;
}
return {
configuration: configuration,
require: require,
CallbackList: CallbackList,
LoadHandler: LoadHandler,
MultiPromise: MultiPromise,
}
})();
// ==== Data === data model and binding
var D = (() => {
var processors = {};
var model = { "": new Model() };
/**
* Navigate object properties and sub-objects based on path string separated by '/'.
* - Array index are treated as another property.
* if the path contains a part starting with '^' this data in the path will be passed to a processor function
* @param {*} data Object to navigate properties
* @param {string|string[]} path Path of desired data on object, can be an array of paths, in case of array of paths the first one with data will be returned
* @param {*} [context] context object, if supplied context objects will be passed to processors
* @param {element} [context.element] DOM element of data processed when calling from binding
*/
function getProperty(data, path, context) {
if (!path)
return data;
if (Array.isArray(path)) {//Array path search
var value;
for (var i in path) {
value = getProperty(data, path[i], context);
if (value !== undefined)
return value;
}
return;
}
var npath = path.split('/');
var pdata = data;
for (var i in npath) {
var part = npath[i];
if (!part)
continue; // "" return same object "////" is the same object too and this is good
if (part[0] == '^') { //Apply processor
var procName = part.substr(1);
var procPars = null;
if (procName.indexOf('(') >= 0) {
if (procName[procName.length - 1] != ')')
throw new Error(`Malformed processor call "${procName}"`);
var pstart = procName.indexOf('(');
procPars = procName.substring(pstart + 1, procName.length - 1);
procName = procName.substring(0, pstart);
}
var fmt = processors[procName];
if (fmt)
pdata = fmt(pdata, { pars: procPars }.merge(context));
else
throw new Error("Processor '" + procName + "' not found.");
} else
pdata = pdata ? pdata[part] : undefined;
}
return (pdata);
}
/**
* Navigate object properties and sub-objects based on path string separated by '/' and sets the value at the end
* - Array index are treated as another property.
* if the path contains a part starting with '^' this data in the path will be passed to a processor function
* if the last node is a processor the value will be passed to the processor.
* @param {*} data Object to navigate properties.
* @param {string} path Path of desired data on object, can be an array of paths, in case of array of paths the first one with data will be returned.
* @param {*} value Value to set on object's path.
* @param {*} [context] context object, if supplied context objects will be passed to processors.
* @param {element} [context.element] DOM element of data processed when calling from binding.
*/
function setProperty(data, path, value, context) {
if (!path)
throw new Error("Path needed");
var npath = path.split('/');
var pdata = data;
var ilast = npath.length - 1;
for (var i = 0; i < ilast; i++) {
var part = npath[i];
if (!part)
continue; // "" return same object "////" is the same object too
if (part[0] == '^') { //Apply processor (for GET here)
var procName = part.substr(1);
var fmt = processors[procName];
if (fmt)
pdata = fmt(pdata, context);
else
throw new Error("Processor '" + procName + "' not found.");
if (!pdata) {
console.warn("A path processor broke the navigation.");
}
} else {
if (!pdata[part])
pdata = pdata[part] = {};
else
pdata = pdata[part];
}
}
var part = npath[ilast];
if (!part)
throw new Error("Path missing last path node, last path node can't be missing");
if (part[0] == '^') { //Apply processor (for SET here)
var procName = part.substr(1);
var fmt = processors[procName];
if (fmt)
fmt(pdata, value, context);
else
throw new Error("Processor '" + procName + "' not found on set.");
} else
pdata[part] = value;
}
if (!Object.prototype.navigate)
Object.defineProperty(Object.prototype, "navigate", {
writable: true,
value: function (path, context) {
return getProperty(this, path, context);
}
});
/**
* Register a processors in available processors
* @param {string} name name of processors (without '^')
* @param {processor_callback} callback
* @callback processor_callback
* @param {*} data data to process
* @param {*} [context] additional data
* @param {element} [context.element] DOM element of data processed when calling from binding
*/
function registerDataProcessor(name, callback) {
processors[name] = callback;
}
/**
* Return the current model
*
* @param {sring} [id] id of model to get, if null or "" the default model will be fetched
*/
function getModel(id) {
if (!id)
id = "";
return model[id];
}
function setModel(id, model) {
return model[id] = model;
}
/**
* Manages the model of data
* @param {*} data data for this model
*/
function Model(data) {
data = data || {};
var bindings = {};
/**
* Return the data on de model at that path
* @param {string} path
* @param {*} context
*/
function getModelProperty(path, context) {
return getProperty(data, path, context);
}
/**
* Sets the data on the model at that path
* @param {string} path
* @param {*} value
* @param {*} context
*/
function setModelProperty(path, value, context) {
setProperty(data, path, value, context);
refreshModelPath(path);
}
/**
* Refresh all the bindings on the specified path and childs
* @param {string} path Path where start updating
*/
function refreshModelPath(path) {
if (path == '/')
path = undefined;
else if (path && path[0] != '/')
path = '/' + path;
for (var p in bindings) {
if (!path ||
(p.length == path.length && p == path) ||
(p.length > path.length && p.substr(0, path.length) == path && p[path.length] == '/')) {
var blist = bindings[p];
var i = 0;
while (i < blist.length) {
var bindEx = blist[i];
if (!document.body.contains(bindEx.node))
blist.splice(i, 1);
else {
if (bindEx.write)
bindEx.write();
i++;
}
}
}
}
}
/**
* Refresh all bindings of this element and childs
* @param {element} element
*/
function refreshModelElement(element) {
for (var p in bindings) {
bindings[p].forEach(bindEx => {
if (element.contains(bindEx.node) && bindEx.write)
bindEx.write();
});
}
}
/**
* Register the binding executor for a binding path in this model
* @param {string} path Binding path
* @param {*} bexec Binding executor object
* @param {*} bexec.node Node or element for bind (if the element is not on document the binding executor gets erased)
* @param {*} bexec.read Read function
* @param {*} bexec.write Write function
*/
function registerBindingExecutor(path, binding) {
if (path && path[0] != '/')
path = '/' + path;
var blist = bindings[path];
if (!blist) {
blist = bindings[path] = [];
}
blist.push(binding);
}
this.getProperty = getModelProperty;
this.setProperty = setModelProperty;
this.refresh = refreshModelPath;
this.refreshElement = refreshModelElement;
this.registerBindingExecutor = registerBindingExecutor;
this.getBindings = () => { return bindings; };
}
/**
* Creates a data binding, a binding contains multiple binding blocks starting with '{' and ending with '}'
* @param {string} path path of binding
*/
function Binding(path) {
function parseBinding(path) {
var bindingParts = [];
var value = "";
var insideBind = false;
for (var i in path) {
var ch = path[i];
if (insideBind) {
if (ch == '}') {
insideBind = false;
if (value)
bindingParts.push({ bind: true, path: value });
value = "";
} else
value += ch;
} else {
if (ch == '{') {
if (value)
bindingParts.push({ bind: false, value: value });
insideBind = true;
value = "";
} else {
value += ch;
}
}
}
if (insideBind)
throw new Error("Not closed binding.");
if (value)
bindingParts.push({ bind: false, value: value });
return bindingParts;
}
var parts = parseBinding(path);
var mdl = model[""];
/**
* Executes the binding and return the value
* @param {*} [context] additional data
* @param {element} [context.element] DOM element of data processed when calling from binding
* @param {string} [type] type of field if "string" undefined values will be returned as ""
*/
function read(context, type) {
var value;
var contextPath = context.element.getContextPath;
for (var i in parts) {
var part = parts[i];
var v;
if (part.bind) {
v = mdl.getProperty(contextPath(part.path), context);
} else
v = part.value;
if (value === undefined)
value = v;
else if (v !== undefined)// If v is undefined no concatenation is done at all
value = String(value) + v;
}
if (type === "string" && (value === undefined || value === null))
value = "";
return value;
}
/**
* Register the binding executor for all binding parts
* @param {*} bexec Binding executor object
* @param {*} bexec.node Node or element for bind (if the element is not on document the binding executor gets erased)
* @param {*} bexec.read Read function
* @param {*} bexec.write Write function
*/
function registerBindingExecutor(bexec) {
for (var i in parts) {
var part = parts[i];
if (part.bind) {
var processoridx = part.path.indexOf("^");
if (processoridx >= 0) {
var path = part.path.substr(0, processoridx);
while (path && path[path.length - 1] == "/")
path = path.substr(0, path.length - 1);
mdl.registerBindingExecutor(path, bexec);
} else
mdl.registerBindingExecutor(part.path, bexec);
}
}
bexec.write();
}
/**
* Binds a text node
* @param {element} textNode text node to bind
*/
function bindTextNode(textNode) {
registerBindingExecutor({
node: textNode,
read: null,
write: function () {
textNode.nodeValue = read({ element: textNode }, "string");
}
});
}
/**
* Binds an element attribute
* @param {*} element
* @param {*} attribute
*/
function bindElementAttribute(element, attribute) {
//TODO: Register events for reading value
function standard() {
return {
node: element,
read: null,
write: function () {
element.setAttribute(attribute, read({ element: element }, "string"));
}
}
}
switch (element.tagName) {//TODO implement special read for inputs select and more
default:
registerBindingExecutor(standard());
break;
}
return element;
}
/**
* Bind repeater nodes
* @param {*} parent Parent node (for document localization)
* @param {*} sibling Next sibling node (for document localization)
* @param {*[]} templates template array of childs to add on each repetition
*/
function bindRepeater(parent, sibling, templates) {
var repeatItems = [];
if (parts.length != 1 || !parts[0].bind)
throw new Error("wolf:repeat does not allow composed bindings, use single one");
var pathbar = parts[0].path;
if (pathbar && pathbar[pathbar.length - 1] != '/')
pathbar += '/';
//v0.1 delete all and refill
function populate(data) {
repeatItems.forEach(item => { try { parent.removeChild(item) } catch { } });
repeatItems = []
if (!data)
return;
for (var k in data) {
templates.forEach(templ => {
var elements = UI.instanceTemplate(templ, { parent: parent, contextPath: pathbar + k });
elements.forEach(element => {
repeatItems.push(element);
parent.insertBefore(element, sibling);
});
})
}
}
registerBindingExecutor({
node: parent,
read: null,
write: function () {
populate(read({ element: parent, mode: "repeater" }));
}
});
}
/**
* Bind an external API
* @param {*} node DOM node
* @param {*} fninit Function to execute at binding init
* @param {*} fnread Function to execute at binding element read (write to model)
* @param {*} fnwrite Function to execute at binding element wrtie (read from model)
*/
function bindExecutor(node, fninit, fnread, fnwrite) {
var fread;
var fwrite = fnwrite ? () => {
fnwrite(read);
} : null;
if (fninit)
init(fninit);
registerBindingExecutor({
node: node,
read: fread,
write: fwrite
});
}
/**
* Return the actual value reflected bi the binding for the specified element
* @param {*} element DOM element
*/
function getValue(element) {
return read({ element: element })
}
this.bindTextNode = bindTextNode;
this.bindElementAttribute = bindElementAttribute;
this.bindRepeater = bindRepeater;
this.bindExecutor = bindExecutor;
this.getValue = getValue;
}
return {
getProperty: getProperty,
setProperty: setProperty,
registerDataProcessor: registerDataProcessor,
getModel: getModel,
setModel: setModel,
Binding: Binding,
};
})()
// ==== UI ==== screen elements and applications handling
var UI = (() => {
var frgs = {}, navigatorController;
/** Initializes an application, an application is only a definition of the container element in the document
* and the url of the application controller, a single web page can contains several applications
* @param {string} ctrlUrl url for the application controller
* @param {element} element the parent document element
*/
function initApp(ctrlUrl, element) {
K.require(ctrlUrl, (ctrl) => {
processElement(element, {
$t: "#app",
$controller: ctrl
}, element.parentElement);
ctrl.init && ctrl.init(element);
});
// NOTE: data-stack es la pila de contextos de dato que se usa en la aplicación y en los bindings
}
var wolfElements = {
/**
* <wolf:fragment>
* fragment definition, fragment can be loaded from urls and can have a cotnroller that is propagated on all childs
*/
"fragment": {
$init: template => {
if (template.id)
frgs["#" + template.id] = template;
/**
* Inserts the element into a parent element (replacing any content)
* @param {element} parentElement
*/
template.$insertTo = function (parentElement) {
var nodes = instanceTemplate(template, { parent: parentElement });
while (parentElement.childNodes.length > 0)
parentElement.removeChild(parentElement.childNodes[0]);
for (var i in nodes)
parentElement.appendChild(nodes[i]);
var ptmpl = parentElement.getTemplate();
if (template.$controller)
if (!ptmpl.$controller || ptmpl.$fragmentedController) {
ptmpl.$controller = template.$controller;
ptmpl.$fragmentedController = true;
} else {
console.warn("wolf: Can't install fragment controller on parent element because already have one");
}
template.$controller && template.$controller.init && template.$controller.init(parentElement);
}
},
$ctor: (template, ext) => {
var nodes = [];
template.$ && template.$.forEach(son => instanceTemplate(son, ext).forEach(sonDOM => nodes.push(sonDOM)));
return nodes;
},
id: {
bindable: false
},
controller: {
bindable: false
}
},
/**
* <wolf:repeat>
* repeat all child elements, also adgust the context data for each repetition
*/
"repeat": {
$init: template => {
if (!template.w.items)
throw new Error("item attribute is mandatory on wolf:repeat");
if (!(template.w.items instanceof D.Binding))
throw new Error("item attribute must be a binding wolf:repeat");
if (!template.c || !template.c.length == 0)
throw new Error("wolf:repeat requires a child");
},
$ctor: template => {
var hook = document.createElement(template.c[0].type);
setTimeout(() => {
template.w.items.bindRepeater(hook.parentElement, hook.nextSibling, template.c);
hook.parentElement.removeChild(hook);//Clear hook
});
return [hook];
},
items: {
bindable: true,
mandatory: true
}
}
}
/**
* Definitions for wolf tag attibutes when processing the elements.
* for extended processors with multiple options (for example events) use a # before the
* processor name (see event processor)
*/
var wolfAttributes = (() => {
return {
/**
* wolf:include
* Includes an external HTML fragment into this element.
*/
"include": {
bindable: false,
processor: function (element, value, template) {
loadFragmentTo(value, element);
}
},
/**
* wolf:repeat
* alias for <wolf:repeat> element
*/
"repeat": {
bindable: true,
initTemplate: template => {
var items = template.repeat;
if (!(items instanceof D.Binding))
throw new Error("Only bindings can be used on xwolf:repeat");
delete template.repeat;
return {
$t: "wolf:repeat",
items: items,
$: [template]
};
}
},
/**
* wolf:context
* set a context path for this object
*/
"context": {
bindable: false,
processor: function (element, value, template) {
element.setContextPath(value);
}
}
}
})();
/**
* Process an instance element from template
* @param {element} element Element being process
* @param {*} template Template of the element
* @param {*} ext Extended data
*/
function processElement(element, template, ext) {
var contextPath = ext ? ext.contextPath : undefined;
var defaultParent = ext ? ext.parent : undefined;
var customController = ext ? ext.customController : undefined;
/**
* Return the associated template to this element
*/
function getTemplate() {
return template;
}
/**
* Return the controller assigned for the element
*/
function getController() {
var supervisor = getControllerElement();
if (supervisor) {
var template = supervisor.getTemplate();
if (typeof (template.$controller) == "string") {
throw new Error("Intermediate controllers not supported right now");
// // NOTE: Not optimal, but intermediate controllers are not optimal too.
// return await Promise.resolve({
// then: (ok, ko) => {
// K.require(template.$controller, ctrl => {
// ok(template.$controller = ctrl);
// });
// }
// });
}
return template.$controller;
}
}
/**
* Return the element having a controller influencing this element
*/
function getControllerElement() {
var node = element;
while (node && node != document.documentElement) {
var template = node.getTemplate();
if (template && template.$controller)
return node;
node = node.getParent();
}
}
/**
* Return the application controller owner of this element
*/
function getApplicationController() {
var app = getApplication();
if (app)
return app.getTemplate().$controller;
}
/**
* Return the application of this element tree
*/
function getApplication() { //TODO: use context, not current DOM path
var node = element;
while (node && node != document.documentElement) {
var template = node.getTemplate();
if (template && template.$t == "#app")
return node;
node = node.getParent();
}
}
/**
* Search all the element tree (from this element) for an element with an id
* @param {string} id id of element to search
*/
function byId(id) { //TODO: use querySelector
if (element.id == id)
return element;
for (var i = 0; i < element.children.length; i++) {
var ele = element.children[i];
if (ele.byId) {
ele = ele.byId(id);
if (ele)
return ele;
}
}
}
/**
* Return the parent of theis element or a parent with a specified id or class
* @param {string} [idorclass] id of element or class if idorclass start with '.'
*/
function getParent(idorclass) { // TODO: Use context not DOM path
var dad = element.parentElement || defaultParent;
if (idorclass) {
while (dad && dad != document.documentElement) {
if (dad.getTemplate && dad.getTemplate().type == "#app")
break;
switch (idorclass[0]) {
case '#':
if ('#' + dad.id == idorclass)
return dad;
break;
case '.':
if (dad.classList.contains(idorclass.substr(1)))
return dad;
break;
default:
if (dad.id == idorclass)
return dad;
}
dad = dad.getParent ? dad.getParent() : dad.parentElement;
}
} else
return dad;
}
/**
* Sets the binding context data, updates all child nodes with relative bindings
* @param {*} data
*/
function setContextPath(path) {
contextPath = path;
D.getModel().refreshElement(element);
}
/**
* Get the current binding context data
* @param {string} path Path for composing
*/
function getContextPath(path) {
// Absolute path
if (path && path[0] == '/')
return path;
var base;
if (template.type == "#app" || (contextPath && contextPath[0] == "/"))
base = contextPath;
else {
base = element.getParent().getContextPath();
if (!base)
base = contextPath;
else {
if (base[base.length - 1] != '/')
base += '/';
if (contextPath)
base = base + contextPath;
}
}
if (!base)
return path;
if (path) {
if (base[base.length - 1] != '/')
base += '/';
base += path;
}
return base;
}
/**
* Include a fragment into this element
* @param {string} url
* @param {loadFragmentTo_callback} callback Called once fragment has been loaded and set on element
*/
function include(url, callback) {
loadFragmentTo(url, element, callback);
}
/**
* Refresh element depending on model data
*/
function refresh() {
D.getModel().refreshElement(element);
}
if (!template.$t) {
element.merge({
// Wolfed text node API
getTemplate: getTemplate,
getController: getController,
getControllerElement: getControllerElement,
getApplication: getApplication,
getApplicationController: getApplicationController,
getParent: getParent,
setContextPath: setContextPath,
getContextPath: getContextPath,
refresh: refresh,
});
// process text
if (template.$ instanceof D.Binding)
template.$.bindTextNode(element);
else
element.nodeValue = template.$;
} else {
element.merge({
// Wolfed element API
getTemplate: getTemplate,
getController: getController,
getControllerElement: getControllerElement,
getApplication: getApplication,
getApplicationController: getApplicationController,
byId: byId,
getParent: getParent,
setContextPath: setContextPath,
getContextPath: getContextPath,
include: include,
refresh: refresh,
});
// process attributes
for (var k in template) {
if (k[0] == "$")
continue;
var value = template[k];
if (typeof value === "function")
value(element);
else if (value instanceof D.Binding)
value.bindElementAttribute(element, k);
else
element.setAttribute(k, value);
}
// process events
function installEvent(event, method) {
if (customController)
element.addEventListener(event, (evt) => {
var evtMethod = customController[method];
if (!evtMethod)
throw new Error(`Method '${method}' not found for event '${k}' in custom controller.`);
evtMethod(element, evt);
});
else
element.addEventListener(event, (evt) => {
var ctrl = element.getController();
var evtMethod = ctrl[method];
if (!evtMethod)
throw new Error(`Method '${method}' not found for event '${k}'.`);
evtMethod(element, evt);
});
}
if (template.$e)
for (var k in template.$e)
installEvent(k, template.$e[k]);
}
template.ctor && template.ctor(element, template, ext);
ext.onRender && ext.onRender(element, template, ext);
}
/**
* Instantiate element from template
* @param {*} template Template to intantiate
* @param {*} ext Extended info
* @param {element} ext.parent Node parent
* @param {string} [ext.contextPath] Initial context path
* @returns {element[]} Array with nodes on template
*/
function instanceTemplate(template, ext) {
if (Array.isArray(template)) {
var result = [];
template.forEach(templ => {
result = result.concat(instanceTemplate(templ, ext));
});
return result;
}
if (!template.$t) {
var node = document.createTextNode("");
processElement(node, template, ext);
return [node];
} else if (template.$w) {
return template.$w.$ctor(template, ext);
} else if (template.$t.substr(0, 5) == "wolf:") {
throw new Error("TEST! Template without precache");
template.$w = wolfElements[template.$T.substr(5)];
return template.$w.$ctor(template, ext);
} else {
var node = document.createElement(template.$t);
processElement(node, template, ext);
if (template.$ && template.$.length) {
var childExt = {}.merge(ext).merge({ parent: node });
delete childExt.contextPath; //TODO: erase the usage of contextPath in ext, or do not cache contextpath when initTemplate is done
template.$.forEach(son => instanceTemplate(son, childExt).forEach(sonDOM => node.appendChild(sonDOM)));
}
template.$onRender && template.$onRender(node, template, ext); //TODO: refactor postInit to $onRender
return [node];
}
}
/**
* Process an element template and it's childs, preparing the logics and binding maps
* @param {element} element
*/
function readTemplate(node, parent) {
/**
* @callback readTemplate_callback
* @param {*} template template processed completely
*/
var templ = {}, initiators = [];
function valOrBinding(val) {
if (typeof val === "string" && val.indexOf('{') >= 0)
return new D.Binding(val);
return val;
}
if (node.nodeType == 8) {
//Ignore element (commentary)
return null;
} else if (node.nodeType == 3) {
var val = node.nodeValue;
if (K.configuration.trimTextNodes)
val = TOOLS.smartTrim(val);
else if (!val.trim())
val = " ";
if (!val)
return null;
if (parent && parent.$t == "script")
templ.$ = val;
else
templ.$ = valOrBinding(val);
} else {
var tagname = templ.$t = node.tagName.toLowerCase();
if (tagname.substr(0, 5) == "wolf:") {// Wolf element!
var wdef = templ.$w = wolfElements[tagname.substr(5)];
if (!wdef)
throw new Error("Unknown element: " + tagname);
node.getAttributeNames().forEach(attr => {
if (attr[0] == "$")
throw new Error(attr + " attribute name is not valid");
attr = attr.toLowerCase();
var attri = wdef[attr];
if (!attri)
throw new Error(tagname + " does not allow " + attr + " attribute");
var aval = valOrBinding(node.getAttribute(attr));
if ((aval instanceof D.Binding) && !attri.bindable)
throw new Error(tagname + " attribute " + attr + " can not be binded");
templ[attr] = aval;
});
for (var k in wdef) {
if (k[0] == "$")
continue;
if (wdef[k].mandatory && !templ[k])
throw new Error(tagname + " attribute " + k + " is mandatory");
}
wdef.$init && initiators.push(wdef.$init);
} else { // Normal element
node.getAttributeNames().forEach(attr => {
if (attr[0] == "$")
throw new Error(attr + " attribute name is not valid");
attr = attr.toLowerCase();
var aval = valOrBinding(node.getAttribute(attr));
if (attr && attr.substr(0, 6) == "event:") {
attr = attr.substr(6);
if (attr[0] == "$")
throw new Error("event:" + attr + " attribute name is not valid");
if (aval instanceof D.Binding)
throw new Error("Events can not be binded");
if (!templ.$e)
templ.$e = {};
templ.$e[attr] = aval;
} else if (attr && attr.substr(0, 5) == "wolf:") {
var attrName = attr.substr(5);
if (attrName[0] == "$")
throw new Error(attr + " attribute name is not valid");
var wattr = wolfAttributes[attrName];
if (!wattr)
throw new Error("Unknown global attribute wolf:" + attr);
if (aval instanceof D.Binding && !wattr.bindable)
throw new Error(attr + " does not allow binding");
(value => templ[attrName] = element => wattr.processor(element, value, templ))(aval);
//TODO: do not like this solution, maily for wolf:repeat attribute because <wolf:repeat> element
// get relocated then repeating tr or tds inside a table.
// Better try to parse the HTML manually when reading templates to avoid node relocations
wattr.initTemplate && initiators.push(wattr.initTemplate);
} else if (attr && attr.substr(0, 5) == "bind:") {
attr = attr.substr(5);
if (attr[0] == "$")
throw new Error("bind:" + attr + " attribute name is not valid");
if (!(aval instanceof D.Binding))
throw new Error("Use bind:#### attributes only for binding");
templ[attr] = aval;
} else {
templ[attr] = aval;
}
});
}
// Process childs
if (templ.$t)
for (var ci = 0; ci < node.childNodes.length; ci++) {
var tn = readTemplate(node.childNodes[ci], templ);
if (tn) {
if (!templ.$)
templ.$ = [];
templ.$.push(tn);
}
}
initiators.forEach(init => {
var ttempl = init(templ);
if (ttempl !== undefined)
templ = ttempl;
});
}
return templ;
}
/**
* Process the fragment template and create the fragment object and template-ready methods
* @param {*} fragmentElement template element to prepare
* @param {processFragmentTemplate_callback} [callback] callback when template preparation has been done
*/
function processFragmentTemplate(fragmentElement, callback) {
// TODO Combie with Read Template and create an unified way to treat element templates
// --- Needed for template repetitions
var fragment = readTemplate(fragmentElement);
if (fragment.controller && typeof (fragment.controller) === "string") {
K.require(fragment.controller, (ctrl) => {
fragment.controller = ctrl;
callback && callback(fragment);
});
} else callback && callback(fragment);
}
/**
* Fetch the fragment form a url and uses the browser parser to return DOM as wolf:fragment
* @param {string} url url of the fragment to load
* @param {fetchFragment_callback} [callback] callback to execute when the fragment has been fetched
*/
function fetchFragment(url, callback) {
/**
* @callback fetchFragment_callback
* @param {*} rootElement Loaded fragment DOM
*/
TOOLS.wGet(url, html => {
var rootElement = document.createElement("wolf:fragment");
rootElement.innerHTML = html;
if (rootElement.children.length == 1 && rootElement.children[0].tagName == "WOLF:FRAGMENT")
rootElement = rootElement.children[0];
callback(rootElement);
});
}
/**
* Load a fragment from the url and creates the internal fragment template
* @param {string} url url of the fragment to load
* @param {loadFragment_callback} [callback] callback to execute when the fragment has been loaded
*/
function loadFragment(url, callback) {
/**
* @callback loadFragment_callback
* @param {*} fragment Loaded fragment template
*/
var fragment = frgs[url];
if (!fragment) {
if (url.length > 0 && url[0] == '#')
throw new Error("named fragment '" + url + "' not loaded");
var cbl = frgs[url] = new K.CallbackList(); //temporal CBL
cbl.add(callback);
fetchFragment(url, rootElement => {
processFragmentTemplate(rootElement, (fragment) => {
cbl.fire([frgs[url] = fragment]);
});
});
} else {
if (fragment instanceof K.CallbackList)
fragment.add(callback);
else
callback(fragment);
}
}
/**
* Load a fragment from URL and inserts into element replacing it's content
* @param {string} url URL of the fragment to load
* @param {element} element Element where set the fragment
* @param {loadFragmentTo_callback} callback Called once fragment has been loaded and set on element
*/
function loadFragmentTo(url, element, callback) {
/**
* @callback loadFragment_callback
* @param {*} fragment Loaded fragment template
* @param {element} element Element to insert fragment
*/
loadFragment(url, (fragment) => {
fragment.$insertTo(element);
callback && callback(fragment, element);
});
}
/**
* Executes an event when a desired fragment has been loaded if the fragment is already loaded executes the callback
*/
function onFragmentReady(url, callback) {
var fragment = frgs[url];
if (!fragment) {
console.error("Only allowed on loaded or loading fragments, if fragment is not references a wait is not possible");
} else {
if (fragment instanceof K.CallbackList)
fragment.add(callback);
else
callback(fragment);
}
}
/**
* Importa un recurso js o css a la página
* @param {string} url Url of the resource to add
* @param {string} [type] Type of resource, if none the type will be the url file extension
*/
function importResource(url, type) {
//Detect type
if (!type) {
var filePath = new URL(url, document.baseURI).pathname;
var dp = filePath.lastIndexOf(".");
if (dp < 0) {
console && console.error(`Can not detect resource type by url '${url}'. Aborting!`);
return;
}
type = filePath.substr(dp + 1);
if (!type) {
console && console.error(`Can not detect resource type by url '${url}'. Aborting!`);
return;
}
}
type = type.toLowerCase();
switch (type) {
case "css":
var elink = document.createElement("link");
elink.href = url;
elink.rel = "stylesheet";
document.head.appendChild(elink);
break;
case "js":
var escript = document.createElement("script");
escript.src = url;
document.head.appendChild(escript);
break;
}
}
/**
* Links a navigation controller to the element
* @param {element} element navigation controller root element
* @param {string|object} navigationMap navigation map as JSON object or string with url of JSON
* @param {function} callback callback when navigation is ready or when naivgation event occurs
*/
function createNavigator(element, navigationMap, callback) {
var current;
if (!navigatorController) {
//Create navigation controller object
navigatorController = (() => {
var navs = [];
function registerNavigator(element, navigator) {
navs.push({ element: element, navigator: navigator });
}
function processHash(hash) {
//TODO get all navigators and procedd to hash change
for (var i in navs) {
var nav = navs[i];
if (document.body.contains(nav.element)) //only for active document elements
nav.navigator.processHash(hash);
}
}
window.addEventListener("hashchange", () => {
processHash(document.location.hash);
}, false);
return {
registerNavigator: registerNavigator,
}
})();
}
if (!element.getController)
throw Error("Only valid for elements inside wolf context");
/**
* Executes the navigation with specified id, if the navigation terget is already done does not reload it.
* @param {string} id id on the navigation map to execute
* @param {object} [data] data of the navigation if any
*/
function doNav(id, data) {
var navEntry = navigationMap[id];
if (!navEntry)
throw new Error(`Navigation "${id}" not defined.`)
current = { id: id, data: data };
var lh = new K.LoadHandler(() => {
if (navEntry.event) {
var eventName = navEntry.event;
var ctrl;
if (eventName[0] == '/') {
eventName = eventName.substr(1);
ctrl = lh.__elem.getApplicationController();
} else
ctrl = lh.__elem.getController();
if (ctrl[eventName])
ctrl[eventName](lh.__elem, id, data);
}
for (var i in nav.onChange) try {
nav.onChange[i](id, data);
} catch { };
});
if (navEntry.set) {
for (var k in navEntry.set) {
var dest = navEntry.set[k];
var elem = element.byId(k);
if (elem) {
lh.enter();
loadFragmentTo(dest, elem, (templ, setElem) => {
lh.__elem = setElem;
lh.leave();
});
}
}
} else { lh.clear(); }
}
/**
* Executes the navigation with specified id, if the navigation terget is already done does not reload it.
* @param {string} id id on the navigation map to execute
* @param {object} [data] data of the navigation if any
*/
function navTo(id, data) {
var navEntry = navigationMap[id];
if (!navEntry)
throw new Error(`Navigation "${id}" not defined.`)
var pattern = "";
data = data || {};
if (navEntry.pattern)
navEntry.pattern.forEach(part => {
var patternPart = part.isData ? data[part.name] : part.name;
pattern += "/" + (patternPart || "");
});
if (pattern)
pattern = pattern.substr(1);
document.location.hash = pattern;
}
/**
* Process the hash string and executes the corresponding navigation
* @param {string} hash
*/
function processHash(hash) {
if (hash && hash[0] == '#')
hash = hash.substr(1);
if (hash) {
hash = hash.split('/');
var candidates = []; //Navigation ids
var navId;
//First step get all candidates
for (var k in navigationMap)
candidates.push(k);
// Filter candidates
for (var i in hash) {
var hpart = hash[i];
var newCa = [];
var newCaVar = [];
var exact = false;
candidates.forEach(k => {
if (!k)
return; //Kill nulls
var nav = navigationMap[k];
if (!nav.pattern || nav.pattern.length <= i)
return;
if (nav.pattern[i].name == hpart && !nav.pattern[i].isData) {
//A exact match (no varialbe) has been found and have preference.
exact = true;
newCa.push(k);
} else
if (!exact && nav.pattern[i].isData)
newCaVar.push(k);
});
if (!exact) //No exact match, allow variable ones
newCa = newCa.concat(newCaVar)
if (newCa.length == 1) {
navId = newCa[0];
break;
} else if (newCa.length == 0) {
navId = candidates[0];
break;
} else
candidates = newCa;
}
if (!navId)
navId = candidates[0];
// Candidate already defined, process it
if (navId) {
var data = {};
var nav = navigationMap[navId];
if (nav.pattern)
for (var i in hash)
if (i < nav.pattern.length && nav.pattern[i].isData)
data[nav.pattern[i].name] = hash[i];
doNav(navId, data);
return;
}
} else
for (var k in navigationMap) {
var navEntry = navigationMap[k];
if (navEntry.pattern == null) {
doNav(k);
return;
}
}
for (var k in navigationMap) {
console.warn("No matching navigation found, navigating to first");
doNav(k);
return;
}
throw new Error("Hash does not have any matching navigation");
}
/**
* Return information about the actually navigation stage
*/
function getCurrentNavigation() {
if (!current)
current = {};
return { id: current.id, data: current.data }
}
var nav = element.navigator = {
navTo: navTo,
processHash: processHash,
getCurrentNavigation: getCurrentNavigation,
onChange: []
}
navigatorController.registerNavigator(element, nav);
/**
* Navigation initialization and data processing
*/
function initNavigation() {
for (var k in navigationMap) {
var navi = navigationMap[k];
if (navi.pattern) {
var path = navi.pattern.split('/');
for (var i in path) {
var ref = path[i];
if (!ref)
continue;
path[i] = ref = {
name: ref
}
if (ref.name[0] == '{') {
ref.name = ref.name.substr(1, ref.name.length - 2);
ref.isData = true;
}
}
navi.pattern = path;
} else
navi.pattern = null;
}
nav.processHash(document.location.hash);
callback && callback(nav);
}
if (typeof navigationMap === 'string') {
TOOLS.loadJSON(navigationMap, data => {
navigationMap = data;
initNavigation();
}, e => {
if (typeof navigationMap === 'string')
throw new Error("Can't load the navigation map at: " + navigationMap + "\n(" + e + ")");
else
throw e;
});
} else {
initNavigation();
}
return nav;
}
/**
* Creates a wolf:xxxx element, use with caution
* @param {string} id Id of the element to register
* @param {*} element Object controller of the element
*/
function registerElement(id, element) {
wolfElements[id] = element;
}
/**
* Clones a templte in deep
* @param {*} templ Template object or array
*/
function cloneTemplate(templ) {
if (!templ)
return;
if (Array.isArray(templ)) {
var result = [];
for (var i = 0; i < templ.length; i++)
result[i] = cloneTemplate(templ[i]);
return result;
}
var clone = {}.merge(templ);
// Does not clone events??
delete clone.$e;
if (templ.$ && Array.isArray(templ.$))
clone.$ = cloneTemplate(templ.$);
return clone;
}
// DRAFT
// /**
// * Fetch an element or multiple by a selector string
// * @param {*} templ Template object
// * @param {string} selector Selector query
// * @param {boolean} multiple Return an array of matches instead of single element
// */
// function queryTemplate(templ, selector, multiple) {
// }
// DRAFT
// /**
// * Easy way to change templates structure
// * @param {*} templ Template object
// * @param {*} data Data structure of template changes
// */
// function hackTemplate(templ, data) {
// }
return {
initApp: initApp,
instanceTemplate: instanceTemplate,
readTemplate: readTemplate,
fetchFragment: fetchFragment,
loadFragment: loadFragment,
loadFragmentTo: loadFragmentTo,
onFragmentReady: onFragmentReady,
import: importResource,
createNavigator: createNavigator,
registerElement: registerElement,
cloneTemplate: cloneTemplate,
// queryTemplate: queryTemplate, DRAFT
// hackTemplate: hackTemplate, DRAFT
}
})();
// ==== TOOLS ==== collection of utility functions
var TOOLS = (() => {
/**
* Process a fetch operation under the wolf standards
* @param {string} url Url to fetch
* @param {string} type Type of data to fetch ("text","json","blob","formData","arrayBuffer")
* @param {fetcher_callback} callback Callback when data is OK
* @param {fetcher_callfail} [callfail] Callback on fail
*/
function fetcher(url, type, callback, callfail) {
/**
* @callback fetcher_callback
* @param {*} data Loaded data
*/
/**
* @callback fetcher_callfail
* @param {error} error Error object
* @param {string} stage Error stage
*/
/**
* Process the error of the fetch
* @param {error} error
* @param {string} stage
*/
function fail(error, stage) {
if (callfail)
callfail(error, stage);
else
console.error(error, stage);
}
if (!url) {
fail(new Error("Missing url"), "init");
return;
}
if (!type) {
fail(new Error("Missing data type"), "init");
return;
}
fetch(url, {
credentials: "same-origin"
}).then(r => {
if (r.ok) {
r[type]()
.then(data => callback(data))
.catch(e => fail(e, "process"));
} else {
fail({ status: r.status, text: r.statusText }, "http")
}
}).catch(e => fail(e, "net"));
}
/**
* Ajax call to fetch text resources
* @param {string} url Url of the resource
* @param {fetcher_callback} callback Callback when data is OK
* @param {fetcher_callfail} callfail Callback on fail
*/
function wGet(url, callback, callfail) {
fetcher(url, "text", callback, callfail);
}
/**
* Ajax call to fetch JSON resources
* @param {string} url Url of the JSON file
* @param {fetcher_callback} callback Callback when data is OK
* @param {fetcher_callfail} callfail Callback on fail
*/
function loadJSON(url, callback, callfail) {
fetcher(url, "json", callback, callfail);
}
/**
* Special trimming close to browser behaviour trimming inside contents too.
* @param {*} s
*/
function innerTrim(s) {
var o = "";
var space = false;
var spaces = " \t\r\n";
for (var i in s) {
var issp = spaces.includes(s[i]);
if (issp && !space) {
space = true;
o += " ";
} else if (!issp) {
space = false;
o += s[i];
}
}
return o;
}
/**
* Special trimming close to browser behaviour.
* @param {*} s
*/
function smartTrim(s) {
var t = s.trim();
if (!t)
return "";
var spaces = " \t\r\n";
var sts = spaces.includes(s[0]);
var ens = spaces.includes(s[s.length - 1]);
return (sts ? " " : "") + t + (ens ? " " : "");
}
/**
* i18n handling class
* @param {string} path Base file path of i18n property files, this sould point to the name of the root file without the .json
* @param {string} [lang] Language code of i18n (optional, by default navigator language)
* @param {function} gcb Callback to execute when lang tree has been chagned and loaded
*/
function I18N(path, lang, gcb) {
const empty = {};
var langTree = [empty, empty, empty];
/**
* Sets the current language code and fetch the language data
* @param {string} code Language code in format xx-XX
* @param {function} cb Callback to execute when lang tree has been loaded
*/
function setLang(code, cb) {
var langsteps = code.split("-");
var langdone = [, ,];
lang = {
lang: langsteps.length > 0 ? langsteps[0].toLowerCase() : "",
country: langsteps.length > 1 ? langsteps[1].toUpperCase() : "",
code: code,
}
function set(i, l) {
langTree[i] = l || empty;
langdone[i] = true;
cb = cb;
if (langdone[0] && langdone[1] && langdone[2])
cb && cb(code);
}
if (langTree[0] == empty)
loadJSON(path + ".json", l => set(0, l), () => set(0));
if (lang.lang)
loadJSON(path + `-${lang.lang}.json`, l => set(1, l), () => set(1));
else
langTree[1] = {};
if (lang.country)
loadJSON(path + `-${lang.lang}-${lang.country}.json`, l => set(2, l), () => set(2));
else
langTree[2] = {};
}
/**
* Return the lenguage information
*/
function getLanguage() {
return lang;
}
/**
* Simple string-value formatter
* @param {string} expression string with the expression
* @param {*} valueObj object with all the values to be expressed
*/
function stringTemplateParser(expression, valueObj) {
const templateMatcher = /{\s?([^{}\s]*)\s?}/g;
let text = expression.replace(templateMatcher, (substring, value, index) => {
value = valueObj[value];
if (!value)
value = "";
return value;
});
return text
}
/**
* Return the text of the language file tree
* @param {string} key
* @param {*} data
*/
function getText(key, data) {
var l = 2;
var txt;
while (l >= 0 && !txt)
txt = langTree[l--][key];
if (!txt)
return "";
return stringTemplateParser(txt, data || {});
}
this.setLang = setLang;
this.getLanguage = getLanguage; //Different name due to the behaviour is a slight different too
this.getText = getText;
if (!lang)
lang = navigator.language || navigator.userLanguage;
setLang(lang, gcb);
}
return {
fetch: fetcher,
wGet: wGet,
loadJSON: loadJSON,
innerTrim: innerTrim,
smartTrim: smartTrim,
I18N: I18N,
}
})()
/**
* Create an extension of wolf framework
* @param {function} extender The function that installs the extension
*/
function wolfExtension(extender) {
extender(K, D, UI, TOOLS);
}
return {
// Kernel
configuration: K.configuration,
require: K.require,
wolfExtension: wolfExtension,
CallbackList: K.CallbackList,
LoadHandler: K.LoadHandler,
MultiPromise: K.MultiPromise,
// Data
getProperty: D.getProperty,
setProperty: D.setProperty,
registerDataProcessor: D.registerDataProcessor,
getModel: D.getModel,
// UI
initApp: UI.initApp,
loadFragment: UI.loadFragment,
loadFragmentTo: UI.loadFragmentTo,
onFragmentReady: UI.onFragmentReady,
import: UI.import,
createNavigator: UI.createNavigator,
// Tools
wGet: TOOLS.wGet,
loadJSON: TOOLS.loadJSON,
smartTrim: TOOLS.smartTrim,
innerTrim: TOOLS.innerTrim,
I18N: TOOLS.I18N,
};
})();